About 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol
1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol (PubChem CID 44404355) has the molecular formula C24H28FN3O
and a molecular weight of 393.50 g/mol. Its IUPAC name is 1-[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]piperidin-1-yl]butan-2-ol.
Molecular Properties
| Compound Name | 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol |
| PubChem CID | 44404355 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]piperidin-1-yl]butan-2-ol |
| SMILES | CCC(CN1CCC(CC1)C2=CC(=C(N2)C3=CC=C(C=C3)F)C4=CC=NC=C4)O |
| InChI | InChI=1S/C24H28FN3O/c1-2-21(29)16-28-13-9-18(10-14-28)23-15-22(17-7-11-26-12-8-17)24(27-23)19-3-5-20(25)6-4-19/h3-8,11-12,15,18,21,27,29H,2,9-10,13-14,16H2,1H3 |
| InChIKey | ZCXGVZVTEWOJMU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | 485 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol?
The IUPAC name of 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol (CID 44404355) is 1-[4-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]piperidin-1-yl]butan-2-ol.
What is the SMILES notation for 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol?
The canonical SMILES for 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol is CCC(CN1CCC(CC1)C2=CC(=C(N2)C3=CC=C(C=C3)F)C4=CC=NC=C4)O.
What is the InChIKey of 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol?
The InChIKey is ZCXGVZVTEWOJMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28FN3O/c1-2-21(29)16-28-13-9-18(10-14-28)23-15-22(17-7-11-26-12-8-17)24(27-23)19-3-5-20(25)6-4-19/h3-8,11-12,15,18,21,27,29H,2,9-10,13-14,16H2,1H3.
What are the key properties of 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol?
1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol has a molecular weight of 393.50 g/mol, XLogP of 3.90, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-{4-[5-(4-Fluoro-phenyl)-4-pyridin-4-yl-1H-pyrrol-2-yl]-piperidin-1-yl}-butan-2-ol is sourced from PubChem (CID 44404355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).