C16H18F3N3O3 — CID 44405279
benzyl N-[(2S)-1-(cyanomethylamino)-5,5,5-trifluoro-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 44405279) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(cyanomethylamino)-5,5,5-trifluoro-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(cyanomethylamino)-5,5,5-trifluoro-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 44405279 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | benzyl N-[(2S)-1-(cyanomethylamino)-5,5,5-trifluoro-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C[C@@H](C(=O)NCC#N)NC(=O)OCC1=CC=CC=C1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O3/c1-11(16(17,18)19)9-13(14(23)21-8-7-20)22-15(24)25-10-12-5-3-2-4-6-12/h2-6,11,13H,8-10H2,1H3,(H,21,23)(H,22,24)/t11?,13-/m0/s1 |
| InChIKey | OVMCXXCFMXEVLU-YUZLPWPTSA-N |
| XLogP | 2.90 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | 496 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|