C26H33N3O2 — CID 44406553
1-(4-methoxy-phenyl)-8-((1S,2S)-2-phenyl-cyclohexyl)-1,3,8-triaza-spiro[4.5]decan-4-one (PubChem CID 44406553) has the molecular formula C26H33N3O2 and a molecular weight of 419.60 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-8-[(1S,2S)-2-phenylcyclohexyl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 1-(4-methoxy-phenyl)-8-((1S,2S)-2-phenyl-cyclohexyl)-1,3,8-triaza-spiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 44406553 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-(4-methoxyphenyl)-8-[(1S,2S)-2-phenylcyclohexyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | COC1=CC=C(C=C1)N2CNC(=O)C23CCN(CC3)[C@H]4CCCC[C@H]4C5=CC=CC=C5 |
| InChI | InChI=1S/C26H33N3O2/c1-31-22-13-11-21(12-14-22)29-19-27-25(30)26(29)15-17-28(18-16-26)24-10-6-5-9-23(24)20-7-3-2-4-8-20/h2-4,7-8,11-14,23-24H,5-6,9-10,15-19H2,1H3,(H,27,30)/t23-,24-/m0/s1 |
| InChIKey | ZHOUQPQHJWNVFX-ZEQRLZLVSA-N |
| XLogP | 4.80 |
| TPSA | 44.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | 604 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|