C21H25NO2S — CID 44418146
2-(3,4-Dimethylphenyl)-3-(4-methoxyphenethyl)-2-methylthiazolidin-4-one (PubChem CID 44418146) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-3-[2-(4-methoxyphenyl)ethyl]-2-methyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(3,4-Dimethylphenyl)-3-(4-methoxyphenethyl)-2-methylthiazolidin-4-one |
|---|---|
| PubChem CID | 44418146 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-3-[2-(4-methoxyphenyl)ethyl]-2-methyl-1,3-thiazolidin-4-one |
| SMILES | CC1=C(C=C(C=C1)C2(N(C(=O)CS2)CCC3=CC=C(C=C3)OC)C)C |
| InChI | InChI=1S/C21H25NO2S/c1-15-5-8-18(13-16(15)2)21(3)22(20(23)14-25-21)12-11-17-6-9-19(24-4)10-7-17/h5-10,13H,11-12,14H2,1-4H3 |
| InChIKey | JZFNWTIJEGVREY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 463 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |