C20H14F3N3O — CID 44418336
2-Phenyl-5-[[4-(trifluoromethoxy)phenyl]methyl]imidazo[4,5-c]pyridine (PubChem CID 44418336) has the molecular formula C20H14F3N3O and a molecular weight of 369.30 g/mol. Its IUPAC name is 2-phenyl-5-[[4-(trifluoromethoxy)phenyl]methyl]imidazo[4,5-c]pyridine.
| Compound Name | 2-Phenyl-5-[[4-(trifluoromethoxy)phenyl]methyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 44418336 |
| Molecular Formula | C20H14F3N3O |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-phenyl-5-[[4-(trifluoromethoxy)phenyl]methyl]imidazo[4,5-c]pyridine |
| SMILES | C1=CC=C(C=C1)C2=NC3=CN(C=CC3=N2)CC4=CC=C(C=C4)OC(F)(F)F |
| InChI | InChI=1S/C20H14F3N3O/c21-20(22,23)27-16-8-6-14(7-9-16)12-26-11-10-17-18(13-26)25-19(24-17)15-4-2-1-3-5-15/h1-11,13H,12H2 |
| InChIKey | YVZZMJPAQODVFB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | 476 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |