C17H24ClN3O — CID 44418512
(S)-N-(4-chlorobenzyl)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 44418512) has the molecular formula C17H24ClN3O and a molecular weight of 321.80 g/mol. Its IUPAC name is (2S)-N-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (S)-N-(4-chlorobenzyl)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 44418512 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2S)-N-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | C1CCN(C1)C[C@@H]2CCCN2C(=O)NCC3=CC=C(C=C3)Cl |
| InChI | InChI=1S/C17H24ClN3O/c18-15-7-5-14(6-8-15)12-19-17(22)21-11-3-4-16(21)13-20-9-1-2-10-20/h5-8,16H,1-4,9-13H2,(H,19,22)/t16-/m0/s1 |
| InChIKey | ZINQVDMUOKSGFB-INIZCTEOSA-N |
| XLogP | 2.80 |
| TPSA | 35.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 365 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |