C9H15NO3 — CID 44424863
ethyl (2S,4S)-2,4-dimethyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (PubChem CID 44424863) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is ethyl (2S,4S)-2,4-dimethyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
| Compound Name | ethyl (2S,4S)-2,4-dimethyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 44424863 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | ethyl (2S,4S)-2,4-dimethyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C[C@@H](C=[N+]1[O-])C)C |
| InChI | InChI=1S/C9H15NO3/c1-4-13-8(11)9(3)5-7(2)6-10(9)12/h6-7H,4-5H2,1-3H3/t7-,9-/m0/s1 |
| InChIKey | UNEXDAIMKPVMLS-CBAPKCEASA-N |
| XLogP | 0.40 |
| TPSA | 55.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 249 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|