C25H28N2O2 — CID 44426500
(S)-N-(1-(1-hydroxy-1-phenylpropyl)piperidin-4-yl)-1-naphthamide (PubChem CID 44426500) has the molecular formula C25H28N2O2 and a molecular weight of 388.50 g/mol. Its IUPAC name is N-[1-[(1S)-1-hydroxy-1-phenylpropyl]piperidin-4-yl]naphthalene-1-carboxamide.
| Compound Name | (S)-N-(1-(1-hydroxy-1-phenylpropyl)piperidin-4-yl)-1-naphthamide |
|---|---|
| PubChem CID | 44426500 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[1-[(1S)-1-hydroxy-1-phenylpropyl]piperidin-4-yl]naphthalene-1-carboxamide |
| SMILES | CC[C@](C1=CC=CC=C1)(N2CCC(CC2)NC(=O)C3=CC=CC4=CC=CC=C43)O |
| InChI | InChI=1S/C25H28N2O2/c1-2-25(29,20-11-4-3-5-12-20)27-17-15-21(16-18-27)26-24(28)23-14-8-10-19-9-6-7-13-22(19)23/h3-14,21,29H,2,15-18H2,1H3,(H,26,28)/t25-/m0/s1 |
| InChIKey | GZABSIWUPRMDGW-VWLOTQADSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | 539 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |