C34H29F2N3O3 — CID 44441747
2-[(5R,14R)-5-amino-14-(4-fluorophenyl)-5-methyl-4,16-dioxo-3-oxa-15-azatricyclo[15.3.1.17,11]docosa-1(20),7,9,11(22),17(21),18-hexaen-19-yl]-6-fluorobenzonitrile (PubChem CID 44441747) has the molecular formula C34H29F2N3O3 and a molecular weight of 565.60 g/mol. Its IUPAC name is 2-[(5R,14R)-5-amino-14-(4-fluorophenyl)-5-methyl-4,16-dioxo-3-oxa-15-azatricyclo[15.3.1.17,11]docosa-1(20),7,9,11(22),17(21),18-hexaen-19-yl]-6-fluorobenzonitrile.
| Compound Name | 2-[(5R,14R)-5-amino-14-(4-fluorophenyl)-5-methyl-4,16-dioxo-3-oxa-15-azatricyclo[15.3.1.17,11]docosa-1(20),7,9,11(22),17(21),18-hexaen-19-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 44441747 |
| Molecular Formula | C34H29F2N3O3 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 2-[(5R,14R)-5-amino-14-(4-fluorophenyl)-5-methyl-4,16-dioxo-3-oxa-15-azatricyclo[15.3.1.17,11]docosa-1(20),7,9,11(22),17(21),18-hexaen-19-yl]-6-fluorobenzonitrile |
| SMILES | C[C@]1(CC2=CC=CC(=C2)CC[C@@H](NC(=O)C3=CC(=CC(=C3)C4=C(C(=CC=C4)F)C#N)COC1=O)C5=CC=C(C=C5)F)N |
| InChI | InChI=1S/C34H29F2N3O3/c1-34(38)18-22-5-2-4-21(14-22)8-13-31(24-9-11-27(35)12-10-24)39-32(40)26-16-23(20-42-33(34)41)15-25(17-26)28-6-3-7-30(36)29(28)19-37/h2-7,9-12,14-17,31H,8,13,18,20,38H2,1H3,(H,39,40)/t31-,34-/m1/s1 |
| InChIKey | HBFIKLBNICKYKN-QIKUIUABSA-N |
| XLogP | 5.60 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | 994 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |