C14H10F3NO3 — CID 44445207
3-(Trifluoromethyl)benzyl 6-oxo-1,6-dihydropyridine-2-carboxylate (PubChem CID 44445207) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 6-oxo-1H-pyridine-2-carboxylate.
| Compound Name | 3-(Trifluoromethyl)benzyl 6-oxo-1,6-dihydropyridine-2-carboxylate |
|---|---|
| PubChem CID | 44445207 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 6-oxo-1H-pyridine-2-carboxylate |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)COC(=O)C2=CC=CC(=O)N2 |
| InChI | InChI=1S/C14H10F3NO3/c15-14(16,17)10-4-1-3-9(7-10)8-21-13(20)11-5-2-6-12(19)18-11/h1-7H,8H2,(H,18,19) |
| InChIKey | KHUYGJKVYSCEOH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 482 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |