About Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate
Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 44448954) has the molecular formula C17H16ClN2NaO2S
and a molecular weight of 370.80 g/mol. Its IUPAC name is sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 44448954 |
| Molecular Formula | C17H16ClN2NaO2S |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)CC1=CN(C2=C1C=CC(=C2)Cl)CC3=NC(=CS3)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H17ClN2O2S.Na/c1-10(2)5-11-7-20(15-6-12(18)3-4-13(11)15)8-16-19-14(9-23-16)17(21)22;/h3-4,6-7,9-10H,5,8H2,1-2H3,(H,21,22);/q;+1/p-1 |
| InChIKey | XADIACVNQCRLIJ-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | 443 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate (CID 44448954) is sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate is CC(C)CC1=CN(C2=C1C=CC(=C2)Cl)CC3=NC(=CS3)C(=O)[O-].[Na+].
What is the InChIKey of Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate?
The InChIKey is XADIACVNQCRLIJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H17ClN2O2S.Na/c1-10(2)5-11-7-20(15-6-12(18)3-4-13(11)15)8-16-19-14(9-23-16)17(21)22;/h3-4,6-7,9-10H,5,8H2,1-2H3,(H,21,22);/q;+1/p-1.
What are the key properties of Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate?
Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate has a molecular weight of 370.80 g/mol, XLogP of not available, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium 2-[[6-chloro-3-(2-methylpropyl)indol-1-yl]methyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 44448954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).