C19H14N6O2S — CID 44456709
4-(12-Phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl)benzenesulfonamide (PubChem CID 44456709) has the molecular formula C19H14N6O2S and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-(12-phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl)benzenesulfonamide.
| Compound Name | 4-(12-Phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 44456709 |
| Molecular Formula | C19H14N6O2S |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-(12-phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl)benzenesulfonamide |
| SMILES | C1=CC=C(C=C1)C2=CN(C3=C2C4=NC=NN4C=N3)C5=CC=C(C=C5)S(=O)(=O)N |
| InChI | InChI=1S/C19H14N6O2S/c20-28(26,27)15-8-6-14(7-9-15)24-10-16(13-4-2-1-3-5-13)17-18(24)22-12-25-19(17)21-11-23-25/h1-12H,(H2,20,26,27) |
| InChIKey | ZJBGXHKPVTTWOH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | 656 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |