About (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid
(Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid (PubChem CID 44458684) has the molecular formula C10H7Cl2NO3
and a molecular weight of 260.07 g/mol. Its IUPAC name is (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid |
| PubChem CID | 44458684 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid |
| SMILES | C1=CC(=C(C=C1C(=O)/C=C(/C(=O)O)\N)Cl)Cl |
| InChI | InChI=1S/C10H7Cl2NO3/c11-6-2-1-5(3-7(6)12)9(14)4-8(13)10(15)16/h1-4H,13H2,(H,15,16)/b8-4- |
| InChIKey | ZSRWYPGHSHDYKN-YWEYNIOJSA-N |
| XLogP | 2.70 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 330 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
The IUPAC name of (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid (CID 44458684) is (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid.
What is the SMILES notation for (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
The canonical SMILES for (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid is C1=CC(=C(C=C1C(=O)/C=C(/C(=O)O)\N)Cl)Cl.
What is the InChIKey of (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
The InChIKey is ZSRWYPGHSHDYKN-YWEYNIOJSA-N. The full InChI is InChI=1S/C10H7Cl2NO3/c11-6-2-1-5(3-7(6)12)9(14)4-8(13)10(15)16/h1-4H,13H2,(H,15,16)/b8-4-.
What are the key properties of (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
(Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid has a molecular weight of 260.07 g/mol, XLogP of 2.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 44458684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).