C26H35N3O4 — CID 44460595
(R)-2-[(S)-1-((S)-3-Methyl-1-phenylcarbamoyl-butylcarbamoyl)-3-p-tolyl-propylamino]-propionic acid (PubChem CID 44460595) has the molecular formula C26H35N3O4 and a molecular weight of 453.60 g/mol. Its IUPAC name is (2R)-2-[[(2S)-1-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-4-(4-methylphenyl)-1-oxobutan-2-yl]amino]propanoic acid.
| Compound Name | (R)-2-[(S)-1-((S)-3-Methyl-1-phenylcarbamoyl-butylcarbamoyl)-3-p-tolyl-propylamino]-propionic acid |
|---|---|
| PubChem CID | 44460595 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | (2R)-2-[[(2S)-1-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-4-(4-methylphenyl)-1-oxobutan-2-yl]amino]propanoic acid |
| SMILES | CC1=CC=C(C=C1)CC[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)NC2=CC=CC=C2)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C26H35N3O4/c1-17(2)16-23(25(31)28-21-8-6-5-7-9-21)29-24(30)22(27-19(4)26(32)33)15-14-20-12-10-18(3)11-13-20/h5-13,17,19,22-23,27H,14-16H2,1-4H3,(H,28,31)(H,29,30)(H,32,33)/t19-,22+,23+/m1/s1 |
| InChIKey | ZKTSRBGPYOEYPS-OIBXWCBGSA-N |
| XLogP | 2.20 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | 625 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |