C27H36N4O4 — CID 44467270
2-[3-(3-methoxyphenyl)-1-oxo-7-(3-piperidin-1-ylpropoxy)pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylacetamide (PubChem CID 44467270) has the molecular formula C27H36N4O4 and a molecular weight of 480.60 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)-1-oxo-7-(3-piperidin-1-ylpropoxy)pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-(3-methoxyphenyl)-1-oxo-7-(3-piperidin-1-ylpropoxy)pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 44467270 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)-1-oxo-7-(3-piperidin-1-ylpropoxy)pyrrolo[1,2-a]pyrazin-2-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1C(=CN2C=C(C=C2C1=O)OCCCN3CCCCC3)C4=CC(=CC=C4)OC |
| InChI | InChI=1S/C27H36N4O4/c1-20(2)28-26(32)19-31-25(21-9-7-10-22(15-21)34-3)18-30-17-23(16-24(30)27(31)33)35-14-8-13-29-11-5-4-6-12-29/h7,9-10,15-18,20H,4-6,8,11-14,19H2,1-3H3,(H,28,32) |
| InChIKey | CKFALHWLBDUMCP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | 751 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|