C34H26F6N6O8S2 — CID 44480570
bis[2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfinyl]-3H-benzimidazol-5-yl] oxalate (PubChem CID 44480570) has the molecular formula C34H26F6N6O8S2 and a molecular weight of 824.70 g/mol. Its IUPAC name is bis[2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-yl] oxalate.
| Compound Name | bis[2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfinyl]-3H-benzimidazol-5-yl] oxalate |
|---|---|
| PubChem CID | 44480570 |
| Molecular Formula | C34H26F6N6O8S2 |
| Molecular Weight | 824.70 g/mol |
| Exact Mass | 824.12 |
| IUPAC Name | bis[2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-yl] oxalate |
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=C(N2)C=C(C=C3)OC(=O)C(=O)OC4=CC5=C(C=C4)N=C(N5)S(=O)CC6=NC=CC(=C6C)OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C34H26F6N6O8S2/c1-17-25(41-9-7-27(17)51-15-33(35,36)37)13-55(49)31-43-21-5-3-19(11-23(21)45-31)53-29(47)30(48)54-20-4-6-22-24(12-20)46-32(44-22)56(50)14-26-18(2)28(8-10-42-26)52-16-34(38,39)40/h3-12H,13-16H2,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | GAGQDFKENOXULV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 227.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | 1320 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|