C31H38N4O7S — CID 44503527
1-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-9-[(4-methoxyphenyl)sulfonylamino]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methyl-3-phenylurea (PubChem CID 44503527) has the molecular formula C31H38N4O7S and a molecular weight of 610.73 g/mol. Its IUPAC name is 1-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-9-[(4-methoxyphenyl)sulfonylamino]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methyl-3-phenylurea.
| Compound Name | 1-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-9-[(4-methoxyphenyl)sulfonylamino]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methyl-3-phenylurea |
|---|---|
| PubChem CID | 44503527 |
| Molecular Formula | C31H38N4O7S |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | 1-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-9-[(4-methoxyphenyl)sulfonylamino]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methyl-3-phenylurea |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3c(c2)CC(=O)N([C@H](C)CO)C[C@@H](C)[C@H](CN(C)C(=O)Nc2ccccc2)O3)cc1 |
| InChI | InChI=1S/C31H38N4O7S/c1-21-18-35(22(2)20-36)30(37)17-23-16-25(33-43(39,40)27-13-11-26(41-4)12-14-27)10-15-28(23)42-29(21)19-34(3)31(38)32-24-8-6-5-7-9-24/h5-16,21-22,29,33,36H,17-20H2,1-4H3,(H,32,38)/t21-,22-,29+/m1/s1 |
| InChIKey | BAZNMWBMLSPWJP-QLVXXPONSA-N |
| XLogP | 3.81 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |