C32H47N3O5 — CID 44504318
N-[[(3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl]-N-methyl-2-phenylacetamide (PubChem CID 44504318) has the molecular formula C32H47N3O5 and a molecular weight of 553.74 g/mol. Its IUPAC name is N-[[(3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[[(3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 44504318 |
| Molecular Formula | C32H47N3O5 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | N-[[(3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl]-N-methyl-2-phenylacetamide |
| SMILES | C[C@@H]1CCCCO[C@@H](CN(C)C(=O)Cc2ccccc2)[C@@H](C)CN([C@H](C)CO)C(=O)c2cc(N(C)C)ccc2O1 |
| InChI | InChI=1S/C32H47N3O5/c1-23-20-35(24(2)22-36)32(38)28-19-27(33(4)5)15-16-29(28)40-25(3)12-10-11-17-39-30(23)21-34(6)31(37)18-26-13-8-7-9-14-26/h7-9,13-16,19,23-25,30,36H,10-12,17-18,20-22H2,1-6H3/t23-,24+,25+,30-/m0/s1 |
| InChIKey | ZGCRSIABJPRXFC-RPQPUBLWSA-N |
| XLogP | 4.25 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|