C25H34FN3O5S — CID 44504362
N-[[(2R,3S)-9-(dimethylamino)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 44504362) has the molecular formula C25H34FN3O5S and a molecular weight of 507.63 g/mol. Its IUPAC name is N-[[(2R,3S)-9-(dimethylamino)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-[[(2R,3S)-9-(dimethylamino)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44504362 |
| Molecular Formula | C25H34FN3O5S |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[[(2R,3S)-9-(dimethylamino)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@H](CN(C)S(=O)(=O)c2ccc(F)cc2)Oc2ccc(N(C)C)cc2CC1=O |
| InChI | InChI=1S/C25H34FN3O5S/c1-17-14-29(18(2)16-30)25(31)13-19-12-21(27(3)4)8-11-23(19)34-24(17)15-28(5)35(32,33)22-9-6-20(26)7-10-22/h6-12,17-18,24,30H,13-16H2,1-5H3/t17-,18+,24-/m0/s1 |
| InChIKey | VDJYAGLGTONBFJ-RHGYRFJNSA-N |
| XLogP | 2.36 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|