C28H43N7O4 — CID 44505421
1-[[(8S,9S)-6-[(2S)-1-hydroxypropan-2-yl]-8-methyl-5-oxo-10-oxa-1,6,14,15-tetrazabicyclo[10.3.0]pentadeca-12,14-dien-9-yl]methyl]-1-methyl-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 44505421) has the molecular formula C28H43N7O4 and a molecular weight of 541.70 g/mol. Its IUPAC name is 1-[[(8S,9S)-6-[(2S)-1-hydroxypropan-2-yl]-8-methyl-5-oxo-10-oxa-1,6,14,15-tetrazabicyclo[10.3.0]pentadeca-12,14-dien-9-yl]methyl]-1-methyl-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[[(8S,9S)-6-[(2S)-1-hydroxypropan-2-yl]-8-methyl-5-oxo-10-oxa-1,6,14,15-tetrazabicyclo[10.3.0]pentadeca-12,14-dien-9-yl]methyl]-1-methyl-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 44505421 |
| Molecular Formula | C28H43N7O4 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | 1-[[(8S,9S)-6-[(2S)-1-hydroxypropan-2-yl]-8-methyl-5-oxo-10-oxa-1,6,14,15-tetrazabicyclo[10.3.0]pentadeca-12,14-dien-9-yl]methyl]-1-methyl-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | C[C@H]1CN([C@@H](C)CO)C(=O)CCCn2nncc2CO[C@@H]1CN(C)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H43N7O4/c1-21-17-34(22(2)19-36)27(37)8-7-15-35-25(16-29-31-35)20-39-26(21)18-32(3)28(38)30-23-9-11-24(12-10-23)33-13-5-4-6-14-33/h9-12,16,21-22,26,36H,4-8,13-15,17-20H2,1-3H3,(H,30,38)/t21-,22-,26+/m0/s1 |
| InChIKey | WJAIMBKFVIKGAD-AOJNWGRGSA-N |
| XLogP | 2.96 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|