C19H25N3O3 — CID 44507596
3-N-hydroxy-1-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzene-1,3-dicarboxamide (PubChem CID 44507596) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-N-hydroxy-1-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-hydroxy-1-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 44507596 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-N-hydroxy-1-N-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethylideneamino]benzene-1,3-dicarboxamide |
| SMILES | CC1=C(C/C=N/NC(=O)c2cccc(C(=O)NO)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H25N3O3/c1-13-6-5-10-19(2,3)16(13)9-11-20-21-17(23)14-7-4-8-15(12-14)18(24)22-25/h4,7-8,11-12,25H,5-6,9-10H2,1-3H3,(H,21,23)(H,22,24)/b20-11+ |
| InChIKey | JAILHQLZLJLZRY-RGVLZGJSSA-N |
| XLogP | 3.44 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|