C18H25N3O5 — CID 44507646
1-N-[(E)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 44507646) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-N-[(E)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[(E)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 44507646 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-N-[(E)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | CC1(C)COC(CCC/C=N/NC(=O)c2ccc(C(=O)NO)cc2)OC1 |
| InChI | InChI=1S/C18H25N3O5/c1-18(2)11-25-15(26-12-18)5-3-4-10-19-20-16(22)13-6-8-14(9-7-13)17(23)21-24/h6-10,15,24H,3-5,11-12H2,1-2H3,(H,20,22)(H,21,23)/b19-10+ |
| InChIKey | ZKEZQGSYBHASTK-VXLYETTFSA-N |
| XLogP | 2.09 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|