C18H25N3O3 — CID 44507744
1-N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 44507744) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 44507744 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-N-[(E)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | CC(C)=CCC[C@@H](C)C/C=N/NC(=O)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C18H25N3O3/c1-13(2)5-4-6-14(3)11-12-19-20-17(22)15-7-9-16(10-8-15)18(23)21-24/h5,7-10,12,14,24H,4,6,11H2,1-3H3,(H,20,22)(H,21,23)/b19-12+/t14-/m1/s1 |
| InChIKey | QTKLSJLNFBDNAI-ONDHQXCVSA-N |
| XLogP | 3.29 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|