About N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide
N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide (PubChem CID 44507762) has the molecular formula C16H29N3O3
and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide.
Molecular Properties
| Compound Name | N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide |
| PubChem CID | 44507762 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide |
| SMILES | CC(C)=CCC[C@H](C)C/C=N/NC(=O)CCCCC(=O)NO |
| InChI | InChI=1S/C16H29N3O3/c1-13(2)7-6-8-14(3)11-12-17-18-15(20)9-4-5-10-16(21)19-22/h7,12,14,22H,4-6,8-11H2,1-3H3,(H,18,20)(H,19,21)/b17-12+/t14-/m0/s1 |
| InChIKey | HRYAAVYGFUAJFF-IQGJIOQQSA-N |
| XLogP | 2.93 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide?
The IUPAC name of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide (CID 44507762) is N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide.
What is the SMILES notation for N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide?
The canonical SMILES for N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide is CC(C)=CCC[C@H](C)C/C=N/NC(=O)CCCCC(=O)NO.
What is the InChIKey of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide?
The InChIKey is HRYAAVYGFUAJFF-IQGJIOQQSA-N. The full InChI is InChI=1S/C16H29N3O3/c1-13(2)7-6-8-14(3)11-12-17-18-15(20)9-4-5-10-16(21)19-22/h7,12,14,22H,4-6,8-11H2,1-3H3,(H,18,20)(H,19,21)/b17-12+/t14-/m0/s1.
What are the key properties of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide?
N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide has a molecular weight of 311.43 g/mol, XLogP of 2.93, 11 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyhexanediamide is sourced from PubChem (CID 44507762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).