About N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide
N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide (PubChem CID 44507898) has the molecular formula C18H33N3O3
and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide |
| PubChem CID | 44507898 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide |
| SMILES | CC(C)=CCC[C@H](C)C/C=N/NC(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C18H33N3O3/c1-15(2)9-8-10-16(3)13-14-19-20-17(22)11-6-4-5-7-12-18(23)21-24/h9,14,16,24H,4-8,10-13H2,1-3H3,(H,20,22)(H,21,23)/b19-14+/t16-/m0/s1 |
| InChIKey | KYOUFUKKUUBUDI-TWQQJCIXSA-N |
| XLogP | 3.71 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide?
The IUPAC name of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide (CID 44507898) is N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide.
What is the SMILES notation for N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide?
The canonical SMILES for N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide is CC(C)=CCC[C@H](C)C/C=N/NC(=O)CCCCCCC(=O)NO.
What is the InChIKey of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide?
The InChIKey is KYOUFUKKUUBUDI-TWQQJCIXSA-N. The full InChI is InChI=1S/C18H33N3O3/c1-15(2)9-8-10-16(3)13-14-19-20-17(22)11-6-4-5-7-12-18(23)21-24/h9,14,16,24H,4-8,10-13H2,1-3H3,(H,20,22)(H,21,23)/b19-14+/t16-/m0/s1.
What are the key properties of N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide?
N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide has a molecular weight of 339.48 g/mol, XLogP of 3.71, 13 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[(3S)-3,7-dimethyloct-6-enylidene]amino]-N'-hydroxyoctanediamide is sourced from PubChem (CID 44507898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).