C29H29NO4 — CID 44511188
(2S,4S)-4-(9H-fluoren-2-yl)-2-(4-hydroxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 44511188) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is (2S,4S)-4-(9H-fluoren-2-yl)-2-(4-hydroxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(9H-fluoren-2-yl)-2-(4-hydroxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 44511188 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (2S,4S)-4-(9H-fluoren-2-yl)-2-(4-hydroxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=C[C@@H](c2ccc3c(c2)Cc2ccccc2-3)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C29H29NO4/c31-14-6-7-15-33-28-19-22(18-27(34-28)29(32)30-24-9-2-1-3-10-24)20-12-13-26-23(16-20)17-21-8-4-5-11-25(21)26/h1-5,8-13,16,18,22,28,31H,6-7,14-15,17,19H2,(H,30,32)/t22-,28+/m1/s1 |
| InChIKey | PEKTYEVDMAYTKC-DFHRPNOPSA-N |
| XLogP | 5.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|