C12H22O7 — CID 44511269
(4R,5S)-5-[(1S)-1,2-bis(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 44511269) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is (4R,5S)-5-[(1S)-1,2-bis(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5S)-5-[(1S)-1,2-bis(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 44511269 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (4R,5S)-5-[(1S)-1,2-bis(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | COCOC[C@H](OCOC)[C@@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C12H22O7/c1-12(2)18-9(5-13)11(19-12)10(17-8-15-4)6-16-7-14-3/h5,9-11H,6-8H2,1-4H3/t9-,10-,11+/m0/s1 |
| InChIKey | CPWDJHCLMBHVLW-GARJFASQSA-N |
| XLogP | 0.31 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|