C17H27NaO10Si — CID 44511277
sodium (4S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(2-trimethylsilylethoxycarbonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-hydroxy-2-oxobutanoate (PubChem CID 44511277) has the molecular formula C17H27NaO10Si and a molecular weight of 442.47 g/mol. Its IUPAC name is sodium (4S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(2-trimethylsilylethoxycarbonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-hydroxy-2-oxobutanoate.
| Compound Name | sodium (4S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(2-trimethylsilylethoxycarbonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-hydroxy-2-oxobutanoate |
|---|---|
| PubChem CID | 44511277 |
| Molecular Formula | C17H27NaO10Si |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | sodium (4S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(2-trimethylsilylethoxycarbonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-hydroxy-2-oxobutanoate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](O)CC(=O)C(=O)[O-])[C@H](OC(=O)OCC[Si](C)(C)C)[C@H]2O1.[Na+] |
| InChI | InChI=1S/C17H28O10Si.Na/c1-17(2)26-13-12(25-16(22)23-6-7-28(3,4)5)11(24-15(13)27-17)9(18)8-10(19)14(20)21;/h9,11-13,15,18H,6-8H2,1-5H3,(H,20,21);/q;+1/p-1/t9-,11+,12-,13+,15+;/m0./s1 |
| InChIKey | UTHNCZQZPQFHEM-UHMPFHKPSA-M |
| XLogP | -3.20 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|