C24H31NO5 — CID 44511682
(5S,6R)-5-[3-(dimethylamino)propyl]-6-phenyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid (PubChem CID 44511682) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (5S,6R)-5-[3-(dimethylamino)propyl]-6-phenyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid.
| Compound Name | (5S,6R)-5-[3-(dimethylamino)propyl]-6-phenyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid |
|---|---|
| PubChem CID | 44511682 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (5S,6R)-5-[3-(dimethylamino)propyl]-6-phenyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol;oxalic acid |
| SMILES | CN(C)CCC[C@@]1(O)c2ccccc2CCC[C@@H]1c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H29NO.C2H2O4/c1-23(2)17-9-16-22(24)20-14-7-6-12-19(20)13-8-15-21(22)18-10-4-3-5-11-18;3-1(4)2(5)6/h3-7,10-12,14,21,24H,8-9,13,15-17H2,1-2H3;(H,3,4)(H,5,6)/t21-,22-;/m1./s1 |
| InChIKey | IVLAJTQLQIEXNY-HLUKFBSCSA-N |
| XLogP | 3.49 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|