C34H39Cl2N3O6S — CID 44511727
2,5-dichlorobenzenesulfonate;[(3R)-1-[2-oxo-2-(pyridin-3-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 44511727) has the molecular formula C34H39Cl2N3O6S and a molecular weight of 688.67 g/mol. Its IUPAC name is 2,5-dichlorobenzenesulfonate;[(3R)-1-[2-oxo-2-(pyridin-3-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | 2,5-dichlorobenzenesulfonate;[(3R)-1-[2-oxo-2-(pyridin-3-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 44511727 |
| Molecular Formula | C34H39Cl2N3O6S |
| Molecular Weight | 688.67 g/mol |
| Exact Mass | 687.19 |
| IUPAC Name | 2,5-dichlorobenzenesulfonate;[(3R)-1-[2-oxo-2-(pyridin-3-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2)Nc1cccnc1.O=S(=O)([O-])c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C28H35N3O3.C6H4Cl2O3S/c32-26(30-24-11-8-16-29-19-24)21-31-17-12-22(13-18-31)25(20-31)34-27(33)28(14-6-1-2-7-15-28)23-9-4-3-5-10-23;7-4-1-2-5(8)6(3-4)12(9,10)11/h3-5,8-11,16,19,22,25H,1-2,6-7,12-15,17-18,20-21H2;1-3H,(H,9,10,11)/t22?,25-,31?;/m0./s1 |
| InChIKey | YQAZARJWJWGAJV-BRKBLGTFSA-N |
| XLogP | 6.36 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|