C37H42N4O7S — CID 44511798
1-hydroxynaphthalene-2-sulfonate;[(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 44511798) has the molecular formula C37H42N4O7S and a molecular weight of 686.83 g/mol. Its IUPAC name is 1-hydroxynaphthalene-2-sulfonate;[(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | 1-hydroxynaphthalene-2-sulfonate;[(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 44511798 |
| Molecular Formula | C37H42N4O7S |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | 1-hydroxynaphthalene-2-sulfonate;[(3R)-1-[2-oxo-2-(pyrazin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2)Nc1cnccn1.O=S(=O)([O-])c1ccc2ccccc2c1O |
| InChI | InChI=1S/C27H34N4O3.C10H8O4S/c32-25(30-24-18-28-14-15-29-24)20-31-16-10-21(11-17-31)23(19-31)34-26(33)27(12-6-1-2-7-13-27)22-8-4-3-5-9-22;11-10-8-4-2-1-3-7(8)5-6-9(10)15(12,13)14/h3-5,8-9,14-15,18,21,23H,1-2,6-7,10-13,16-17,19-20H2;1-6,11H,(H,12,13,14)/t21?,23-,31?;/m0./s1 |
| InChIKey | WNWHLDBUZWJLIV-JYJMLYEESA-N |
| XLogP | 5.31 |
| TPSA | 158.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|