C6H8O4 — CID 44511908
(4S,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-one (PubChem CID 44511908) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is (4S,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-one.
| Compound Name | (4S,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 44511908 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (4S,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-one |
| SMILES | O=C1C=C[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H8O4/c7-3-1-2-4(8)6(10)5(3)9/h1-3,5-7,9-10H/t3-,5+,6+/m0/s1 |
| InChIKey | UDGPTYYVDNKAPG-OTWZMJIISA-N |
| XLogP | -1.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |