C31H37FN6O2 — CID 44512001
N-[(3R)-3-[4-[N-[(6-cyano-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-6-fluoro-2,4-dimethylpyridine-3-carboxamide (PubChem CID 44512001) has the molecular formula C31H37FN6O2 and a molecular weight of 544.68 g/mol. Its IUPAC name is N-[(3R)-3-[4-[N-[(6-cyano-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-6-fluoro-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | N-[(3R)-3-[4-[N-[(6-cyano-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-6-fluoro-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 44512001 |
| Molecular Formula | C31H37FN6O2 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | N-[(3R)-3-[4-[N-[(6-cyano-2-pyridinyl)methyl]-4-methoxyanilino]piperidin-1-yl]butyl]-6-fluoro-2,4-dimethylpyridine-3-carboxamide |
| SMILES | COc1ccc(N(Cc2cccc(C#N)n2)C2CCN([C@H](C)CCNC(=O)c3c(C)cc(F)nc3C)CC2)cc1 |
| InChI | InChI=1S/C31H37FN6O2/c1-21-18-29(32)35-23(3)30(21)31(39)34-15-12-22(2)37-16-13-27(14-17-37)38(26-8-10-28(40-4)11-9-26)20-25-7-5-6-24(19-33)36-25/h5-11,18,22,27H,12-17,20H2,1-4H3,(H,34,39)/t22-/m1/s1 |
| InChIKey | GQCGTFZJPSNMME-JOCHJYFZSA-N |
| XLogP | 4.79 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|