About hexan-3-imine
hexan-3-imine (PubChem CID 44512023) has the molecular formula C6H13N
and a molecular weight of 99.18 g/mol. Its IUPAC name is hexan-3-imine.
Molecular Properties
| Compound Name | hexan-3-imine |
| PubChem CID | 44512023 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | hexan-3-imine |
| SMILES | [H]/N=C(\CC)CCC |
| InChI | InChI=1S/C6H13N/c1-3-5-6(7)4-2/h7H,3-5H2,1-2H3/b7-6+ |
| InChIKey | DKFPSBUVEPXGOL-VOTSOKGWSA-N |
| XLogP | 2.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze hexan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-imine?
The IUPAC name of hexan-3-imine (CID 44512023) is hexan-3-imine.
What is the SMILES notation for hexan-3-imine?
The canonical SMILES for hexan-3-imine is [H]/N=C(\CC)CCC.
What is the InChIKey of hexan-3-imine?
The InChIKey is DKFPSBUVEPXGOL-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H13N/c1-3-5-6(7)4-2/h7H,3-5H2,1-2H3/b7-6+.
What are the key properties of hexan-3-imine?
hexan-3-imine has a molecular weight of 99.18 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-imine is sourced from PubChem (CID 44512023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).