C26H24F7N5O4 — CID 44512211
1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 44512211) has the molecular formula C26H24F7N5O4 and a molecular weight of 603.50 g/mol. Its IUPAC name is 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 44512211 |
| Molecular Formula | C26H24F7N5O4 |
| Molecular Weight | 603.50 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | 1-[2-fluoro-4-[4-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperazine-1-carbonyl]phenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(C(=O)N3CCN(Cc4ccc(C(O)(C(F)(F)F)C(F)(F)F)cc4)CC3)cc2F)no1 |
| InChI | InChI=1S/C26H24F7N5O4/c1-15-12-21(36-42-15)35-23(40)34-20-7-4-17(13-19(20)27)22(39)38-10-8-37(9-11-38)14-16-2-5-18(6-3-16)24(41,25(28,29)30)26(31,32)33/h2-7,12-13,41H,8-11,14H2,1H3,(H2,34,35,36,40) |
| InChIKey | DVQRXOZFKGGKAP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |