C33H44FN5O3 — CID 44512349
6-fluoro-N-[(3R)-3-[4-[4-(2-methoxyethoxy)-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 44512349) has the molecular formula C33H44FN5O3 and a molecular weight of 577.75 g/mol. Its IUPAC name is 6-fluoro-N-[(3R)-3-[4-[4-(2-methoxyethoxy)-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-[(3R)-3-[4-[4-(2-methoxyethoxy)-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 44512349 |
| Molecular Formula | C33H44FN5O3 |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | 6-fluoro-N-[(3R)-3-[4-[4-(2-methoxyethoxy)-N-[(4-methyl-3-pyridinyl)methyl]anilino]piperidin-1-yl]butyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | COCCOc1ccc(N(Cc2cnccc2C)C2CCN([C@H](C)CCNC(=O)c3c(C)cc(F)nc3C)CC2)cc1 |
| InChI | InChI=1S/C33H44FN5O3/c1-23-10-14-35-21-27(23)22-39(28-6-8-30(9-7-28)42-19-18-41-5)29-12-16-38(17-13-29)25(3)11-15-36-33(40)32-24(2)20-31(34)37-26(32)4/h6-10,14,20-21,25,29H,11-13,15-19,22H2,1-5H3,(H,36,40)/t25-/m1/s1 |
| InChIKey | DBIYOXJHYGPARD-RUZDIDTESA-N |
| XLogP | 5.25 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|