C18H24O8 — CID 44512486
[(E,2R,3R,4R)-3,4-diacetyloxy-7-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate (PubChem CID 44512486) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is [(E,2R,3R,4R)-3,4-diacetyloxy-7-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate.
| Compound Name | [(E,2R,3R,4R)-3,4-diacetyloxy-7-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 44512486 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(E,2R,3R,4R)-3,4-diacetyloxy-7-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hept-6-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@@H](C)OC(C)=O)[C@@H](C/C=C/[C@H]1CC=CC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C18H24O8/c1-11(23-12(2)19)18(25-14(4)21)16(24-13(3)20)9-5-7-15-8-6-10-17(22)26-15/h5-7,10-11,15-16,18H,8-9H2,1-4H3/b7-5+/t11-,15+,16-,18-/m1/s1 |
| InChIKey | MCXAMJAYXFXQPD-DYOCFBNBSA-N |
| XLogP | 1.62 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|