C30F26 — CID 44512756
1,2,3,4,5,6,8-heptafluoro-7-[1,3,4,5,6,7,8-heptafluoro-9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-bis(trifluoromethyl)fluorene (PubChem CID 44512756) has the molecular formula C30F26 and a molecular weight of 854.28 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptafluoro-7-[1,3,4,5,6,7,8-heptafluoro-9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-bis(trifluoromethyl)fluorene.
| Compound Name | 1,2,3,4,5,6,8-heptafluoro-7-[1,3,4,5,6,7,8-heptafluoro-9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-bis(trifluoromethyl)fluorene |
|---|---|
| PubChem CID | 44512756 |
| Molecular Formula | C30F26 |
| Molecular Weight | 854.28 g/mol |
| Exact Mass | 853.96 |
| IUPAC Name | 1,2,3,4,5,6,8-heptafluoro-7-[1,3,4,5,6,7,8-heptafluoro-9,9-bis(trifluoromethyl)fluoren-2-yl]-9,9-bis(trifluoromethyl)fluorene |
| SMILES | Fc1c(F)c(F)c2c(c1F)-c1c(F)c(F)c(-c3c(F)c(F)c4c(c3F)C(C(F)(F)F)(C(F)(F)F)c3c(F)c(F)c(F)c(F)c3-4)c(F)c1C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C30F26/c31-11-5(17(37)13(33)1-3-9(19(39)23(43)21(41)15(3)35)25(7(1)11,27(45,46)47)28(48,49)50)6-12(32)8-2(14(34)18(6)38)4-10(20(40)24(44)22(42)16(4)36)26(8,29(51,52)53)30(54,55)56 |
| InChIKey | MRWHMIQSCRGWLY-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.28 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|