C16H15BrN2O3 — CID 44512898
1-(2-bromo-1-hydroxy-3-quinolin-6-ylpropyl)pyrrolidine-2,5-dione (PubChem CID 44512898) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is 1-(2-bromo-1-hydroxy-3-quinolin-6-ylpropyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2-bromo-1-hydroxy-3-quinolin-6-ylpropyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 44512898 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 1-(2-bromo-1-hydroxy-3-quinolin-6-ylpropyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1C(O)C(Br)Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H15BrN2O3/c17-12(16(22)19-14(20)5-6-15(19)21)9-10-3-4-13-11(8-10)2-1-7-18-13/h1-4,7-8,12,16,22H,5-6,9H2 |
| InChIKey | XQICLDVOGLSMHO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|