C8H13NO2 — CID 44513060
(1S,7R,8S)-1-hydroxy-7-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 44513060) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (1S,7R,8S)-1-hydroxy-7-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,7R,8S)-1-hydroxy-7-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 44513060 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (1S,7R,8S)-1-hydroxy-7-methyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C[C@@H]1CCN2C(=O)C[C@H](O)[C@H]12 |
| InChI | InChI=1S/C8H13NO2/c1-5-2-3-9-7(11)4-6(10)8(5)9/h5-6,8,10H,2-4H2,1H3/t5-,6+,8+/m1/s1 |
| InChIKey | ZGJQIXMTRVELLU-CHKWXVPMSA-N |
| XLogP | -0.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |