About 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one
3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one (PubChem CID 44513256) has the molecular formula C22H19N5O3S
and a molecular weight of 433.49 g/mol. Its IUPAC name is 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one |
| PubChem CID | 44513256 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one |
| SMILES | COCCOc1cnc2ccc(Cn3nnc4ccn(-c5cccs5)c(=O)c43)cc2c1 |
| InChI | InChI=1S/C22H19N5O3S/c1-29-8-9-30-17-12-16-11-15(4-5-18(16)23-13-17)14-27-21-19(24-25-27)6-7-26(22(21)28)20-3-2-10-31-20/h2-7,10-13H,8-9,14H2,1H3 |
| InChIKey | FDSDLKQVKLJTNN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one?
The IUPAC name of 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one (CID 44513256) is 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one.
What is the SMILES notation for 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one?
The canonical SMILES for 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one is COCCOc1cnc2ccc(Cn3nnc4ccn(-c5cccs5)c(=O)c43)cc2c1.
What is the InChIKey of 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one?
The InChIKey is FDSDLKQVKLJTNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5O3S/c1-29-8-9-30-17-12-16-11-15(4-5-18(16)23-13-17)14-27-21-19(24-25-27)6-7-26(22(21)28)20-3-2-10-31-20/h2-7,10-13H,8-9,14H2,1H3.
What are the key properties of 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one?
3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one has a molecular weight of 433.49 g/mol, XLogP of 3.27, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(2-methoxyethoxy)quinolin-6-yl]methyl]-5-thiophen-2-yltriazolo[4,5-c]pyridin-4-one is sourced from PubChem (CID 44513256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).