About 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one
5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one (PubChem CID 44513470) has the molecular formula C19H24Cl2N2O2
and a molecular weight of 383.32 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one |
| PubChem CID | 44513470 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one |
| SMILES | CCCCCCC(C)(C)c1nc(O)c(-c2cc(Cl)cc(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H24Cl2N2O2/c1-4-5-6-7-8-19(2,3)18-22-16(24)15(17(25)23-18)12-9-13(20)11-14(21)10-12/h9-11H,4-8H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | FGOXXIFUQLRBAF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one?
The IUPAC name of 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one (CID 44513470) is 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one is CCCCCCC(C)(C)c1nc(O)c(-c2cc(Cl)cc(Cl)c2)c(=O)[nH]1.
What is the InChIKey of 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one?
The InChIKey is FGOXXIFUQLRBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Cl2N2O2/c1-4-5-6-7-8-19(2,3)18-22-16(24)15(17(25)23-18)12-9-13(20)11-14(21)10-12/h9-11H,4-8H2,1-3H3,(H2,22,23,24,25).
What are the key properties of 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one?
5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one has a molecular weight of 383.32 g/mol, XLogP of 5.70, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-4-hydroxy-2-(2-methyloctan-2-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 44513470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).