C23H20N6O2 — CID 44513656
8,11-diphenyl-3,4,7,9,11,13-hexazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,8-triene-5,12-dione (PubChem CID 44513656) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 8,11-diphenyl-3,4,7,9,11,13-hexazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,8-triene-5,12-dione.
| Compound Name | 8,11-diphenyl-3,4,7,9,11,13-hexazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,8-triene-5,12-dione |
|---|---|
| PubChem CID | 44513656 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 8,11-diphenyl-3,4,7,9,11,13-hexazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,8-triene-5,12-dione |
| SMILES | O=C1CN2C(=NN1)C1=C(N=C2c2ccccc2)N(c2ccccc2)C(=O)N2CCCC12 |
| InChI | InChI=1S/C23H20N6O2/c30-18-14-28-20(15-8-3-1-4-9-15)24-21-19(22(28)26-25-18)17-12-7-13-27(17)23(31)29(21)16-10-5-2-6-11-16/h1-6,8-11,17H,7,12-14H2,(H,25,30) |
| InChIKey | ZZLZYIDDIKTHQM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |