C25H29N7O3 — CID 44513888
1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-(4-methylphenyl)urea (PubChem CID 44513888) has the molecular formula C25H29N7O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 44513888 |
| Molecular Formula | C25H29N7O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3nc(N4CCOCC4)nc(N4CCOCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C25H29N7O3/c1-18-2-6-20(7-3-18)26-25(33)27-21-8-4-19(5-9-21)22-28-23(31-10-14-34-15-11-31)30-24(29-22)32-12-16-35-17-13-32/h2-9H,10-17H2,1H3,(H2,26,27,33) |
| InChIKey | RAOFVTJVOVNPMR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |