C22H18N6O2 — CID 44513970
7,10-diphenyl-3,4,6,8,10,12-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione (PubChem CID 44513970) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 7,10-diphenyl-3,4,6,8,10,12-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione.
| Compound Name | 7,10-diphenyl-3,4,6,8,10,12-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione |
|---|---|
| PubChem CID | 44513970 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 7,10-diphenyl-3,4,6,8,10,12-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2,7-triene-5,11-dione |
| SMILES | O=C1N(c2ccccc2)c2nc(-c3ccccc3)n3c(=O)[nH]nc3c2C2CCCN12 |
| InChI | InChI=1S/C22H18N6O2/c29-21-25-24-20-17-16-12-7-13-26(16)22(30)27(15-10-5-2-6-11-15)19(17)23-18(28(20)21)14-8-3-1-4-9-14/h1-6,8-11,16H,7,12-13H2,(H,25,29) |
| InChIKey | RZXKOEKWWWZGLD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |