C22H18F3N5OS — CID 44513976
3-[4-morpholin-4-yl-8-(trifluoromethyl)quinolin-3-yl]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 44513976) has the molecular formula C22H18F3N5OS and a molecular weight of 457.48 g/mol. Its IUPAC name is 3-[4-morpholin-4-yl-8-(trifluoromethyl)quinolin-3-yl]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-morpholin-4-yl-8-(trifluoromethyl)quinolin-3-yl]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 44513976 |
| Molecular Formula | C22H18F3N5OS |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 3-[4-morpholin-4-yl-8-(trifluoromethyl)quinolin-3-yl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)(F)c1cccc2c(N3CCOCC3)c(-c3n[nH]c(=S)n3-c3ccccc3)cnc12 |
| InChI | InChI=1S/C22H18F3N5OS/c23-22(24,25)17-8-4-7-15-18(17)26-13-16(19(15)29-9-11-31-12-10-29)20-27-28-21(32)30(20)14-5-2-1-3-6-14/h1-8,13H,9-12H2,(H,28,32) |
| InChIKey | YPZLDCFHUXJUJX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|