C20H30O5 — CID 44514015
methyl 6-hydroxy-2,6-dimethyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoate (PubChem CID 44514015) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 6-hydroxy-2,6-dimethyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoate.
| Compound Name | methyl 6-hydroxy-2,6-dimethyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoate |
|---|---|
| PubChem CID | 44514015 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | methyl 6-hydroxy-2,6-dimethyl-8-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoate |
| SMILES | COC(=O)C(C)CCCC(C)(O)CCC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C20H30O5/c1-12(19(23)25-6)8-7-10-20(5,24)11-9-16-15(4)17(21)13(2)14(3)18(16)22/h12,24H,7-11H2,1-6H3 |
| InChIKey | KZZJIEHIKZJMSF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|