C16H18O2S2 — CID 44514249
(2R,3R)-1,4-bis(phenylsulfanyl)butane-2,3-diol (PubChem CID 44514249) has the molecular formula C16H18O2S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (2R,3R)-1,4-bis(phenylsulfanyl)butane-2,3-diol.
| Compound Name | (2R,3R)-1,4-bis(phenylsulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 44514249 |
| Molecular Formula | C16H18O2S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2R,3R)-1,4-bis(phenylsulfanyl)butane-2,3-diol |
| SMILES | O[C@@H](CSc1ccccc1)[C@@H](O)CSc1ccccc1 |
| InChI | InChI=1S/C16H18O2S2/c17-15(11-19-13-7-3-1-4-8-13)16(18)12-20-14-9-5-2-6-10-14/h1-10,15-18H,11-12H2/t15-,16-/m0/s1 |
| InChIKey | LKJUDZXFDWJPFQ-HOTGVXAUSA-N |
| XLogP | 3.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |