C15H6F5NO4S — CID 44514323
(2,3,4,5,6-pentafluorophenyl) 3-phenyl-1,2-oxazole-5-sulfonate (PubChem CID 44514323) has the molecular formula C15H6F5NO4S and a molecular weight of 391.27 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-phenyl-1,2-oxazole-5-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-phenyl-1,2-oxazole-5-sulfonate |
|---|---|
| PubChem CID | 44514323 |
| Molecular Formula | C15H6F5NO4S |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-phenyl-1,2-oxazole-5-sulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C15H6F5NO4S/c16-10-11(17)13(19)15(14(20)12(10)18)25-26(22,23)9-6-8(21-24-9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | ZIDVEPZAEVVTEY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|