C20H31NO2 — CID 44515112
(1S,3R)-1'-hexyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine] (PubChem CID 44515112) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (1S,3R)-1'-hexyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine].
| Compound Name | (1S,3R)-1'-hexyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine] |
|---|---|
| PubChem CID | 44515112 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (1S,3R)-1'-hexyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine] |
| SMILES | CCCCCCN1CCC[C@]2(C1)O[C@@H](OC)Cc1ccccc12 |
| InChI | InChI=1S/C20H31NO2/c1-3-4-5-8-13-21-14-9-12-20(16-21)18-11-7-6-10-17(18)15-19(22-2)23-20/h6-7,10-11,19H,3-5,8-9,12-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | PDZIFOILZWGZSR-WOJBJXKFSA-N |
| XLogP | 4.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|